C12H17ClIN3OSi — CID 170546086
2-[(3-chloro-5-iodopyrrolo[2,3-c]pyridazin-7-yl)methoxy]ethyl-trimethylsilane (PubChem CID 170546086) has the molecular formula C12H17ClIN3OSi and a molecular weight of 409.73 g/mol. Its IUPAC name is 2-[(3-chloro-5-iodopyrrolo[2,3-c]pyridazin-7-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(3-chloro-5-iodopyrrolo[2,3-c]pyridazin-7-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 170546086 |
| Molecular Formula | C12H17ClIN3OSi |
| Molecular Weight | 409.73 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 2-[(3-chloro-5-iodopyrrolo[2,3-c]pyridazin-7-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(I)c2cc(Cl)nnc21 |
| InChI | InChI=1S/C12H17ClIN3OSi/c1-19(2,3)5-4-18-8-17-7-10(14)9-6-11(13)15-16-12(9)17/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | AKCJEBQUZAVMHR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|