C14H22IN3O2Si — CID 167537057
5-iodo-2,3-dimethyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 167537057) has the molecular formula C14H22IN3O2Si and a molecular weight of 419.34 g/mol. Its IUPAC name is 5-iodo-2,3-dimethyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 5-iodo-2,3-dimethyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 167537057 |
| Molecular Formula | C14H22IN3O2Si |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 5-iodo-2,3-dimethyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(I)cn2COCC[Si](C)(C)C)c(=O)n1C |
| InChI | InChI=1S/C14H22IN3O2Si/c1-10-16-13-12(14(19)17(10)2)11(15)8-18(13)9-20-6-7-21(3,4)5/h8H,6-7,9H2,1-5H3 |
| InChIKey | NLVXQKGLNKDFFO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|