C24H33Cl3I2N6O3Si2 — CID 167542684
2-chloro-5-iodo-7-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one;2-[(2,4-dichloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane (PubChem CID 167542684) has the molecular formula C24H33Cl3I2N6O3Si2 and a molecular weight of 869.91 g/mol. Its IUPAC name is 2-chloro-5-iodo-7-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one;2-[(2,4-dichloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-chloro-5-iodo-7-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one;2-[(2,4-dichloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 167542684 |
| Molecular Formula | C24H33Cl3I2N6O3Si2 |
| Molecular Weight | 869.91 g/mol |
| Exact Mass | 867.93 |
| IUPAC Name | 2-chloro-5-iodo-7-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one;2-[(2,4-dichloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(I)c2c(=O)[nH]c(Cl)nc21.C[Si](C)(C)CCOCn1cc(I)c2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C12H16Cl2IN3OSi.C12H17ClIN3O2Si/c1-20(2,3)5-4-19-7-18-6-8(15)9-10(13)16-12(14)17-11(9)18;1-20(2,3)5-4-19-7-17-6-8(14)9-10(17)15-12(13)16-11(9)18/h6H,4-5,7H2,1-3H3;6H,4-5,7H2,1-3H3,(H,15,16,18) |
| InChIKey | BJXFHPDUNVPDMH-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.91 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|