C11H19N3O4Si — CID 175614777
methyl 4-nitroso-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate (PubChem CID 175614777) has the molecular formula C11H19N3O4Si and a molecular weight of 285.38 g/mol. Its IUPAC name is methyl 4-nitroso-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate.
| Compound Name | methyl 4-nitroso-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 175614777 |
| Molecular Formula | C11H19N3O4Si |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 4-nitroso-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(COCC[Si](C)(C)C)cc1N=O |
| InChI | InChI=1S/C11H19N3O4Si/c1-17-11(15)10-9(13-16)7-14(12-10)8-18-5-6-19(2,3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | CSXMPYCHCRRNMS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|