C16H22BrN3O4Si — CID 156635103
methyl 5-(4-bromophenoxy)-1-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate (PubChem CID 156635103) has the molecular formula C16H22BrN3O4Si and a molecular weight of 428.36 g/mol. Its IUPAC name is methyl 5-(4-bromophenoxy)-1-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate.
| Compound Name | methyl 5-(4-bromophenoxy)-1-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 156635103 |
| Molecular Formula | C16H22BrN3O4Si |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | methyl 5-(4-bromophenoxy)-1-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(COCC[Si](C)(C)C)c1Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H22BrN3O4Si/c1-22-16(21)14-15(24-13-7-5-12(17)6-8-13)20(19-18-14)11-23-9-10-25(2,3)4/h5-8H,9-11H2,1-4H3 |
| InChIKey | LFBUJMHPPRMYDF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|