C16H21BrN4O5Si — CID 156694530
methyl 5-(5-bromo-3-nitro-2-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate (PubChem CID 156694530) has the molecular formula C16H21BrN4O5Si and a molecular weight of 457.36 g/mol. Its IUPAC name is methyl 5-(5-bromo-3-nitro-2-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate.
| Compound Name | methyl 5-(5-bromo-3-nitro-2-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 156694530 |
| Molecular Formula | C16H21BrN4O5Si |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | methyl 5-(5-bromo-3-nitro-2-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ncc(Br)cc2[N+](=O)[O-])n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C16H21BrN4O5Si/c1-25-16(22)12-8-13(15-14(21(23)24)7-11(17)9-18-15)20(19-12)10-26-5-6-27(2,3)4/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | WXEOLKDLHPESKS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 109.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|