C25H29BrN4O5SSi — CID 140878903
methyl 4-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-1-(4-methylphenyl)sulfonylpyrrole-2-carboxylate (PubChem CID 140878903) has the molecular formula C25H29BrN4O5SSi and a molecular weight of 605.59 g/mol. Its IUPAC name is methyl 4-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-1-(4-methylphenyl)sulfonylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-1-(4-methylphenyl)sulfonylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 140878903 |
| Molecular Formula | C25H29BrN4O5SSi |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | methyl 4-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-1-(4-methylphenyl)sulfonylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2nn(COCC[Si](C)(C)C)c3ncc(Br)cc23)cn1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H29BrN4O5SSi/c1-17-6-8-20(9-7-17)36(32,33)30-15-18(12-22(30)25(31)34-2)23-21-13-19(26)14-27-24(21)29(28-23)16-35-10-11-37(3,4)5/h6-9,12-15H,10-11,16H2,1-5H3 |
| InChIKey | JHISVJFOPFGLQK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 105.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|