C22H28BrN3O3Si — CID 171761366
7-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-4-methyl-2,3-dihydrochromen-4-ol (PubChem CID 171761366) has the molecular formula C22H28BrN3O3Si and a molecular weight of 490.47 g/mol. Its IUPAC name is 7-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-4-methyl-2,3-dihydrochromen-4-ol.
| Compound Name | 7-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-4-methyl-2,3-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 171761366 |
| Molecular Formula | C22H28BrN3O3Si |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 7-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-4-methyl-2,3-dihydrochromen-4-ol |
| SMILES | CC1(O)CCOc2cc(-c3nn(COCC[Si](C)(C)C)c4ncc(Br)cc34)ccc21 |
| InChI | InChI=1S/C22H28BrN3O3Si/c1-22(27)7-8-29-19-11-15(5-6-18(19)22)20-17-12-16(23)13-24-21(17)26(25-20)14-28-9-10-30(2,3)4/h5-6,11-13,27H,7-10,14H2,1-4H3 |
| InChIKey | HYYHBGXPZZUNLY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|