C13H19BrN2O2Si — CID 66779522
5-bromo-1-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one (PubChem CID 66779522) has the molecular formula C13H19BrN2O2Si and a molecular weight of 343.30 g/mol. Its IUPAC name is 5-bromo-1-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 5-bromo-1-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 66779522 |
| Molecular Formula | C13H19BrN2O2Si |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 5-bromo-1-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one |
| SMILES | C[Si](C)(C)CCOCN1C(=O)Cc2cc(Br)cnc21 |
| InChI | InChI=1S/C13H19BrN2O2Si/c1-19(2,3)5-4-18-9-16-12(17)7-10-6-11(14)8-15-13(10)16/h6,8H,4-5,7,9H2,1-3H3 |
| InChIKey | CPRJNAUANBWOEN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|