C19H26BrClN2O2Si — CID 156771651
5-bromo-4-chloro-3,3-bis(prop-2-enyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-one (PubChem CID 156771651) has the molecular formula C19H26BrClN2O2Si and a molecular weight of 457.87 g/mol. Its IUPAC name is 5-bromo-4-chloro-3,3-bis(prop-2-enyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 5-bromo-4-chloro-3,3-bis(prop-2-enyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 156771651 |
| Molecular Formula | C19H26BrClN2O2Si |
| Molecular Weight | 457.87 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 5-bromo-4-chloro-3,3-bis(prop-2-enyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-one |
| SMILES | C=CCC1(CC=C)C(=O)N(COCC[Si](C)(C)C)c2ncc(Br)c(Cl)c21 |
| InChI | InChI=1S/C19H26BrClN2O2Si/c1-6-8-19(9-7-2)15-16(21)14(20)12-22-17(15)23(18(19)24)13-25-10-11-26(3,4)5/h6-7,12H,1-2,8-11,13H2,3-5H3 |
| InChIKey | XSUQEABEBVBVNM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.87 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|