C14H19BrClIN2OSi — CID 67280459
2-[2-(5-bromo-4-chloro-3-iodopyrrolo[2,3-b]pyridin-1-yl)ethoxy]ethyl-trimethylsilane (PubChem CID 67280459) has the molecular formula C14H19BrClIN2OSi and a molecular weight of 501.67 g/mol. Its IUPAC name is 2-[2-(5-bromo-4-chloro-3-iodopyrrolo[2,3-b]pyridin-1-yl)ethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[2-(5-bromo-4-chloro-3-iodopyrrolo[2,3-b]pyridin-1-yl)ethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67280459 |
| Molecular Formula | C14H19BrClIN2OSi |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 499.92 |
| IUPAC Name | 2-[2-(5-bromo-4-chloro-3-iodopyrrolo[2,3-b]pyridin-1-yl)ethoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCCn1cc(I)c2c(Cl)c(Br)cnc21 |
| InChI | InChI=1S/C14H19BrClIN2OSi/c1-21(2,3)7-6-20-5-4-19-9-11(17)12-13(16)10(15)8-18-14(12)19/h8-9H,4-7H2,1-3H3 |
| InChIKey | HRRVLPMFHOYFQX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|