C14H19BrN4OSi — CID 141466960
2-[(3-bromo-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methoxy]ethyl-trimethylsilane (PubChem CID 141466960) has the molecular formula C14H19BrN4OSi and a molecular weight of 367.32 g/mol. Its IUPAC name is 2-[(3-bromo-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(3-bromo-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 141466960 |
| Molecular Formula | C14H19BrN4OSi |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2-[(3-bromo-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(Br)c2c1ncc1nccn12 |
| InChI | InChI=1S/C14H19BrN4OSi/c1-21(2,3)7-6-20-10-18-9-11(15)13-14(18)17-8-12-16-4-5-19(12)13/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | ZBGKHXRWWSALGY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|