C18H30BrN3OSi — CID 168774100
2-[[5-bromo-2-(3,3-dimethylbutyl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 168774100) has the molecular formula C18H30BrN3OSi and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[[5-bromo-2-(3,3-dimethylbutyl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-2-(3,3-dimethylbutyl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 168774100 |
| Molecular Formula | C18H30BrN3OSi |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-[[5-bromo-2-(3,3-dimethylbutyl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)(C)CCc1ncc2c(Br)cn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C18H30BrN3OSi/c1-18(2,3)8-7-16-20-11-14-15(19)12-22(17(14)21-16)13-23-9-10-24(4,5)6/h11-12H,7-10,13H2,1-6H3 |
| InChIKey | PQBFXFXVIWJEHN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|