C19H31BrN4OSi — CID 157362664
2-[[7-bromo-3-(4,4-dimethylpiperidin-1-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 157362664) has the molecular formula C19H31BrN4OSi and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[[7-bromo-3-(4,4-dimethylpiperidin-1-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[7-bromo-3-(4,4-dimethylpiperidin-1-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 157362664 |
| Molecular Formula | C19H31BrN4OSi |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[[7-bromo-3-(4,4-dimethylpiperidin-1-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC1(C)CCN(c2cnc3c(Br)cn(COCC[Si](C)(C)C)c3n2)CC1 |
| InChI | InChI=1S/C19H31BrN4OSi/c1-19(2)6-8-23(9-7-19)16-12-21-17-15(20)13-24(18(17)22-16)14-25-10-11-26(3,4)5/h12-13H,6-11,14H2,1-5H3 |
| InChIKey | BIUYCVIXTZAQRC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|