C18H20Br2Cl2N6OSi — CID 157451268
7-bromo-3-chloro-5H-pyrrolo[2,3-b]pyrazine;2-[(7-bromo-3-chloropyrrolo[2,3-b]pyrazin-5-yl)methoxy]ethyl-trimethylsilane (PubChem CID 157451268) has the molecular formula C18H20Br2Cl2N6OSi and a molecular weight of 595.20 g/mol. Its IUPAC name is 7-bromo-3-chloro-5H-pyrrolo[2,3-b]pyrazine;2-[(7-bromo-3-chloropyrrolo[2,3-b]pyrazin-5-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 7-bromo-3-chloro-5H-pyrrolo[2,3-b]pyrazine;2-[(7-bromo-3-chloropyrrolo[2,3-b]pyrazin-5-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 157451268 |
| Molecular Formula | C18H20Br2Cl2N6OSi |
| Molecular Weight | 595.20 g/mol |
| Exact Mass | 591.92 |
| IUPAC Name | 7-bromo-3-chloro-5H-pyrrolo[2,3-b]pyrazine;2-[(7-bromo-3-chloropyrrolo[2,3-b]pyrazin-5-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(Br)c2ncc(Cl)nc21.Clc1cnc2c(Br)c[nH]c2n1 |
| InChI | InChI=1S/C12H17BrClN3OSi.C6H3BrClN3/c1-19(2,3)5-4-18-8-17-7-9(13)11-12(17)16-10(14)6-15-11;7-3-1-10-6-5(3)9-2-4(8)11-6/h6-7H,4-5,8H2,1-3H3;1-2H,(H,10,11) |
| InChIKey | BSVGZPNQTUPOGG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.20 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|