C27H37ClN6OSi — CID 158580861
2-[[7-(4-chloro-2-methyl-2H-benzimidazol-5-yl)-3-(4,4-dimethylpiperidin-1-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 158580861) has the molecular formula C27H37ClN6OSi and a molecular weight of 525.17 g/mol. Its IUPAC name is 2-[[7-(4-chloro-2-methyl-2H-benzimidazol-5-yl)-3-(4,4-dimethylpiperidin-1-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[7-(4-chloro-2-methyl-2H-benzimidazol-5-yl)-3-(4,4-dimethylpiperidin-1-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 158580861 |
| Molecular Formula | C27H37ClN6OSi |
| Molecular Weight | 525.17 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 2-[[7-(4-chloro-2-methyl-2H-benzimidazol-5-yl)-3-(4,4-dimethylpiperidin-1-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC1N=c2ccc(-c3cn(COCC[Si](C)(C)C)c4nc(N5CCC(C)(C)CC5)cnc34)c(Cl)c2=N1 |
| InChI | InChI=1S/C27H37ClN6OSi/c1-18-30-21-8-7-19(23(28)25(21)31-18)20-16-34(17-35-13-14-36(4,5)6)26-24(20)29-15-22(32-26)33-11-9-27(2,3)10-12-33/h7-8,15-16,18H,9-14,17H2,1-6H3 |
| InChIKey | HTFWGTLSVULRKQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.17 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|