C30H41ClFN7O3Si — CID 172719925
tert-butyl N-[(3R,4S)-1-[7-(4-chloro-2-methylindazol-5-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-3-yl]-3-fluoropiperidin-4-yl]carbamate (PubChem CID 172719925) has the molecular formula C30H41ClFN7O3Si and a molecular weight of 630.24 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-1-[7-(4-chloro-2-methylindazol-5-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-3-yl]-3-fluoropiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-1-[7-(4-chloro-2-methylindazol-5-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-3-yl]-3-fluoropiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 172719925 |
| Molecular Formula | C30H41ClFN7O3Si |
| Molecular Weight | 630.24 g/mol |
| Exact Mass | 629.27 |
| IUPAC Name | tert-butyl N-[(3R,4S)-1-[7-(4-chloro-2-methylindazol-5-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-3-yl]-3-fluoropiperidin-4-yl]carbamate |
| SMILES | Cn1cc2c(Cl)c(-c3cn(COCC[Si](C)(C)C)c4nc(N5CC[C@H](NC(=O)OC(C)(C)C)[C@H](F)C5)cnc34)ccc2n1 |
| InChI | InChI=1S/C30H41ClFN7O3Si/c1-30(2,3)42-29(40)34-24-10-11-38(17-22(24)32)25-14-33-27-20(19-8-9-23-21(26(19)31)15-37(4)36-23)16-39(28(27)35-25)18-41-12-13-43(5,6)7/h8-9,14-16,22,24H,10-13,17-18H2,1-7H3,(H,34,40)/t22-,24+/m1/s1 |
| InChIKey | GJEPCDLOOLBRMP-VWNXMTODSA-N |
| XLogP | 6.39 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.24 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|