C33H48ClN7O4Si — CID 166027244
tert-butyl N-[1-[5-(4-chloro-2-ethylindazol-5-yl)-3-methyl-4-oxo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]azepan-4-yl]carbamate (PubChem CID 166027244) has the molecular formula C33H48ClN7O4Si and a molecular weight of 670.33 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(4-chloro-2-ethylindazol-5-yl)-3-methyl-4-oxo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]azepan-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-(4-chloro-2-ethylindazol-5-yl)-3-methyl-4-oxo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]azepan-4-yl]carbamate |
|---|---|
| PubChem CID | 166027244 |
| Molecular Formula | C33H48ClN7O4Si |
| Molecular Weight | 670.33 g/mol |
| Exact Mass | 669.32 |
| IUPAC Name | tert-butyl N-[1-[5-(4-chloro-2-ethylindazol-5-yl)-3-methyl-4-oxo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]azepan-4-yl]carbamate |
| SMILES | CCn1cc2c(Cl)c(-c3cn(COCC[Si](C)(C)C)c4nc(N5CCCC(NC(=O)OC(C)(C)C)CC5)n(C)c(=O)c34)ccc2n1 |
| InChI | InChI=1S/C33H48ClN7O4Si/c1-9-41-20-25-26(37-41)13-12-23(28(25)34)24-19-40(21-44-17-18-46(6,7)8)29-27(24)30(42)38(5)31(36-29)39-15-10-11-22(14-16-39)35-32(43)45-33(2,3)4/h12-13,19-20,22H,9-11,14-18,21H2,1-8H3,(H,35,43) |
| InChIKey | LUCOFKWJUGDDHR-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.33 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|