C28H35Cl2N7O3Si — CID 175800374
[8-[7-(3,4-dichloro-2-methylindazol-5-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-3-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid (PubChem CID 175800374) has the molecular formula C28H35Cl2N7O3Si and a molecular weight of 616.63 g/mol. Its IUPAC name is [8-[7-(3,4-dichloro-2-methylindazol-5-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-3-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid.
| Compound Name | [8-[7-(3,4-dichloro-2-methylindazol-5-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-3-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 175800374 |
| Molecular Formula | C28H35Cl2N7O3Si |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | [8-[7-(3,4-dichloro-2-methylindazol-5-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-3-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid |
| SMILES | Cn1nc2ccc(-c3cn(COCC[Si](C)(C)C)c4nc(N5C6CCC5CC(NC(=O)O)C6)cnc34)c(Cl)c2c1Cl |
| InChI | InChI=1S/C28H35Cl2N7O3Si/c1-35-26(30)23-21(34-35)8-7-19(24(23)29)20-14-36(15-40-9-10-41(2,3)4)27-25(20)31-13-22(33-27)37-17-5-6-18(37)12-16(11-17)32-28(38)39/h7-8,13-14,16-18,32H,5-6,9-12,15H2,1-4H3,(H,38,39) |
| InChIKey | BPFACCDCPGIHKN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|