C19H29F2N5OSi — CID 178072673
2-[[6-(6-azaspiro[2.5]octan-6-yl)-3-(difluoromethyl)pyrazolo[3,4-b]pyrazin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 178072673) has the molecular formula C19H29F2N5OSi and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[[6-(6-azaspiro[2.5]octan-6-yl)-3-(difluoromethyl)pyrazolo[3,4-b]pyrazin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-(6-azaspiro[2.5]octan-6-yl)-3-(difluoromethyl)pyrazolo[3,4-b]pyrazin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 178072673 |
| Molecular Formula | C19H29F2N5OSi |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2-[[6-(6-azaspiro[2.5]octan-6-yl)-3-(difluoromethyl)pyrazolo[3,4-b]pyrazin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(C(F)F)c2ncc(N3CCC4(CC3)CC4)nc21 |
| InChI | InChI=1S/C19H29F2N5OSi/c1-28(2,3)11-10-27-13-26-18-16(15(24-26)17(20)21)22-12-14(23-18)25-8-6-19(4-5-19)7-9-25/h12,17H,4-11,13H2,1-3H3 |
| InChIKey | NTGOVIAUTSDWBA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|