C13H18ClF2N3OSi — CID 167528226
2-[[4-chloro-3-(difluoromethyl)pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 167528226) has the molecular formula C13H18ClF2N3OSi and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-[[4-chloro-3-(difluoromethyl)pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-chloro-3-(difluoromethyl)pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 167528226 |
| Molecular Formula | C13H18ClF2N3OSi |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[[4-chloro-3-(difluoromethyl)pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(C(F)F)c2c(Cl)nccc21 |
| InChI | InChI=1S/C13H18ClF2N3OSi/c1-21(2,3)7-6-20-8-19-9-4-5-17-12(14)10(9)11(18-19)13(15)16/h4-5,13H,6-8H2,1-3H3 |
| InChIKey | SFNXMORHWKMKSQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|