C13H18F3N3O2Si — CID 177301450
3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 177301450) has the molecular formula C13H18F3N3O2Si and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[4,3-c]pyridin-4-one.
| Compound Name | 3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[4,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 177301450 |
| Molecular Formula | C13H18F3N3O2Si |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | C[Si](C)(C)CCOCn1nc(C(F)(F)F)c2c(=O)[nH]ccc21 |
| InChI | InChI=1S/C13H18F3N3O2Si/c1-22(2,3)7-6-21-8-19-9-4-5-17-12(20)10(9)11(18-19)13(14,15)16/h4-5H,6-8H2,1-3H3,(H,17,20) |
| InChIKey | DKLGTZVJCRQSGW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|