C11H17F3N2O2Si — CID 175932254
5-deuterio-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one (PubChem CID 175932254) has the molecular formula C11H17F3N2O2Si and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-deuterio-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one.
| Compound Name | 5-deuterio-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 175932254 |
| Molecular Formula | C11H17F3N2O2Si |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-deuterio-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
| SMILES | [2H]c1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O2Si/c1-19(2,3)7-6-18-8-16-10(17)9(4-5-15-16)11(12,13)14/h4-5H,6-8H2,1-3H3/i4D |
| InChIKey | JGEOUKFZPDHCIJ-QYKNYGDISA-N |
| XLogP | 2.57 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|