C17H28F3N3O6Si — CID 164854732
2-hydroxy-3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]propanoic acid (PubChem CID 164854732) has the molecular formula C17H28F3N3O6Si and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-hydroxy-3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]propanoic acid.
| Compound Name | 2-hydroxy-3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]propanoic acid |
|---|---|
| PubChem CID | 164854732 |
| Molecular Formula | C17H28F3N3O6Si |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-hydroxy-3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]propanoic acid |
| SMILES | C[C@@H](COCC(O)C(=O)O)Nc1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C17H28F3N3O6Si/c1-11(8-29-9-13(24)16(26)27)22-12-7-21-23(10-28-5-6-30(2,3)4)15(25)14(12)17(18,19)20/h7,11,13,22,24H,5-6,8-10H2,1-4H3,(H,26,27)/t11-,13?/m0/s1 |
| InChIKey | XWLOEUFFWZDNEX-AMGKYWFPSA-N |
| XLogP | 1.84 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|