C25H35F7N8O4Si — CID 174218086
2-fluoro-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]acetamide (PubChem CID 174218086) has the molecular formula C25H35F7N8O4Si and a molecular weight of 672.68 g/mol. Its IUPAC name is 2-fluoro-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]acetamide.
| Compound Name | 2-fluoro-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 174218086 |
| Molecular Formula | C25H35F7N8O4Si |
| Molecular Weight | 672.68 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | 2-fluoro-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]acetamide |
| SMILES | CC(CONC(=O)C(F)N1CCN(c2ncc(C(F)(F)F)cn2)CC1)Nc1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C25H35F7N8O4Si/c1-16(36-18-13-35-40(15-43-9-10-45(2,3)4)22(42)19(18)25(30,31)32)14-44-37-21(41)20(26)38-5-7-39(8-6-38)23-33-11-17(12-34-23)24(27,28)29/h11-13,16,20,36H,5-10,14-15H2,1-4H3,(H,37,41) |
| InChIKey | HEYKLDCMAQGKML-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|