C28H41F6N7O4Si — CID 174227949
2-methyl-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]-2-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propanamide (PubChem CID 174227949) has the molecular formula C28H41F6N7O4Si and a molecular weight of 681.75 g/mol. Its IUPAC name is 2-methyl-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]-2-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propanamide.
| Compound Name | 2-methyl-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]-2-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 174227949 |
| Molecular Formula | C28H41F6N7O4Si |
| Molecular Weight | 681.75 g/mol |
| Exact Mass | 681.29 |
| IUPAC Name | 2-methyl-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]-2-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propanamide |
| SMILES | CC(CONC(=O)C(C)(C)C1CCN(c2ncc(C(F)(F)F)cn2)CC1)Nc1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C28H41F6N7O4Si/c1-18(38-21-15-37-41(17-44-11-12-46(4,5)6)23(42)22(21)28(32,33)34)16-45-39-24(43)26(2,3)19-7-9-40(10-8-19)25-35-13-20(14-36-25)27(29,30)31/h13-15,18-19,38H,7-12,16-17H2,1-6H3,(H,39,43) |
| InChIKey | FLPFDSKYVDOAKQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|