C29H39F4N7O4Si — CID 174107555
2-[1-(6-fluoroquinazolin-2-yl)piperidin-4-yl]-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]acetamide (PubChem CID 174107555) has the molecular formula C29H39F4N7O4Si and a molecular weight of 653.75 g/mol. Its IUPAC name is 2-[1-(6-fluoroquinazolin-2-yl)piperidin-4-yl]-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]acetamide.
| Compound Name | 2-[1-(6-fluoroquinazolin-2-yl)piperidin-4-yl]-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]acetamide |
|---|---|
| PubChem CID | 174107555 |
| Molecular Formula | C29H39F4N7O4Si |
| Molecular Weight | 653.75 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | 2-[1-(6-fluoroquinazolin-2-yl)piperidin-4-yl]-N-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propoxy]acetamide |
| SMILES | CC(CONC(=O)CC1CCN(c2ncc3cc(F)ccc3n2)CC1)Nc1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C29H39F4N7O4Si/c1-19(36-24-16-35-40(18-43-11-12-45(2,3)4)27(42)26(24)29(31,32)33)17-44-38-25(41)13-20-7-9-39(10-8-20)28-34-15-21-14-22(30)5-6-23(21)37-28/h5-6,14-16,19-20,36H,7-13,17-18H2,1-4H3,(H,38,41) |
| InChIKey | CASYFLGHGLMRCP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.75 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|