C20H26ClF3N4O5Si — CID 175531251
6-chloro-2-oxo-1-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propyl]pyridine-3-carboxylic acid (PubChem CID 175531251) has the molecular formula C20H26ClF3N4O5Si and a molecular weight of 522.98 g/mol. Its IUPAC name is 6-chloro-2-oxo-1-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propyl]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-oxo-1-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175531251 |
| Molecular Formula | C20H26ClF3N4O5Si |
| Molecular Weight | 522.98 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 6-chloro-2-oxo-1-[2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]propyl]pyridine-3-carboxylic acid |
| SMILES | CC(Cn1c(Cl)ccc(C(=O)O)c1=O)Nc1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C20H26ClF3N4O5Si/c1-12(10-27-15(21)6-5-13(17(27)29)19(31)32)26-14-9-25-28(11-33-7-8-34(2,3)4)18(30)16(14)20(22,23)24/h5-6,9,12,26H,7-8,10-11H2,1-4H3,(H,31,32) |
| InChIKey | ZDFBMVUZPUTYQL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.98 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|