C14H12ClF3N4O4 — CID 167472161
6-chloro-2-oxo-1-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propyl]pyridine-3-carboxylic acid (PubChem CID 167472161) has the molecular formula C14H12ClF3N4O4 and a molecular weight of 392.72 g/mol. Its IUPAC name is 6-chloro-2-oxo-1-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propyl]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-oxo-1-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167472161 |
| Molecular Formula | C14H12ClF3N4O4 |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 6-chloro-2-oxo-1-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propyl]pyridine-3-carboxylic acid |
| SMILES | C[C@@H](Cn1c(Cl)ccc(C(=O)O)c1=O)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C14H12ClF3N4O4/c1-6(5-22-9(15)3-2-7(12(22)24)13(25)26)20-8-4-19-21-11(23)10(8)14(16,17)18/h2-4,6H,5H2,1H3,(H,25,26)(H2,20,21,23)/t6-/m0/s1 |
| InChIKey | SCYGHWDRUUQIGG-LURJTMIESA-N |
| XLogP | 1.80 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|