C9H10Cl2F3N3O2 — CID 175845860
4-[1-(dichloromethoxy)propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 175845860) has the molecular formula C9H10Cl2F3N3O2 and a molecular weight of 320.10 g/mol. Its IUPAC name is 4-[1-(dichloromethoxy)propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[1-(dichloromethoxy)propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 175845860 |
| Molecular Formula | C9H10Cl2F3N3O2 |
| Molecular Weight | 320.10 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 4-[1-(dichloromethoxy)propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | CC(COC(Cl)Cl)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C9H10Cl2F3N3O2/c1-4(3-19-8(10)11)16-5-2-15-17-7(18)6(5)9(12,13)14/h2,4,8H,3H2,1H3,(H2,16,17,18) |
| InChIKey | ZHEBWYZSCYZSBX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.10 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|