C8H10F3N3O2 — CID 167173452
4-[[(2R)-1-hydroxypropan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 167173452) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 4-[[(2R)-1-hydroxypropan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[[(2R)-1-hydroxypropan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 167173452 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-[[(2R)-1-hydroxypropan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | C[C@H](CO)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O2/c1-4(3-15)13-5-2-12-14-7(16)6(5)8(9,10)11/h2,4,15H,3H2,1H3,(H2,13,14,16)/t4-/m1/s1 |
| InChIKey | GJYSYXDOWSXZPP-SCSAIBSYSA-N |
| XLogP | 0.58 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |