C6H10N4O3 — CID 82238092
2-[(5-nitro-1H-pyrazol-4-yl)amino]propan-1-ol (PubChem CID 82238092) has the molecular formula C6H10N4O3 and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-[(5-nitro-1H-pyrazol-4-yl)amino]propan-1-ol.
| Compound Name | 2-[(5-nitro-1H-pyrazol-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 82238092 |
| Molecular Formula | C6H10N4O3 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-[(5-nitro-1H-pyrazol-4-yl)amino]propan-1-ol |
| SMILES | CC(CO)Nc1cn[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H10N4O3/c1-4(3-11)8-5-2-7-9-6(5)10(12)13/h2,4,8,11H,3H2,1H3,(H,7,9) |
| InChIKey | MLSRLVNQKPQSEC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|