C9H16N4O3 — CID 114988516
3-[(5-nitro-1H-pyrazol-4-yl)-propan-2-ylamino]propan-1-ol (PubChem CID 114988516) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-[(5-nitro-1H-pyrazol-4-yl)-propan-2-ylamino]propan-1-ol.
| Compound Name | 3-[(5-nitro-1H-pyrazol-4-yl)-propan-2-ylamino]propan-1-ol |
|---|---|
| PubChem CID | 114988516 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-[(5-nitro-1H-pyrazol-4-yl)-propan-2-ylamino]propan-1-ol |
| SMILES | CC(C)N(CCCO)c1cn[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N4O3/c1-7(2)12(4-3-5-14)8-6-10-11-9(8)13(15)16/h6-7,14H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | HFWXCZDMZSAIGU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|