C8H15N5O2 — CID 114988005
N',N'-dimethyl-N-(5-nitro-1H-pyrazol-4-yl)propane-1,3-diamine (PubChem CID 114988005) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is N',N'-dimethyl-N-(5-nitro-1H-pyrazol-4-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(5-nitro-1H-pyrazol-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114988005 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N',N'-dimethyl-N-(5-nitro-1H-pyrazol-4-yl)propane-1,3-diamine |
| SMILES | CN(C)CCCNc1cn[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H15N5O2/c1-12(2)5-3-4-9-7-6-10-11-8(7)13(14)15/h6,9H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | NNERGAHTUXUJSS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|