C6H11N5O4S — CID 114996232
3-[(5-nitro-1H-pyrazol-4-yl)amino]propane-1-sulfonamide (PubChem CID 114996232) has the molecular formula C6H11N5O4S and a molecular weight of 249.25 g/mol. Its IUPAC name is 3-[(5-nitro-1H-pyrazol-4-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(5-nitro-1H-pyrazol-4-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 114996232 |
| Molecular Formula | C6H11N5O4S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 3-[(5-nitro-1H-pyrazol-4-yl)amino]propane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCNc1cn[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H11N5O4S/c7-16(14,15)3-1-2-8-5-4-9-10-6(5)11(12)13/h4,8H,1-3H2,(H,9,10)(H2,7,14,15) |
| InChIKey | POWPBCCFLKKNDF-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|