C12H16F3N3O5 — CID 146218813
3-[(2R,3S)-3-hydroxy-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]butoxy]propanoic acid (PubChem CID 146218813) has the molecular formula C12H16F3N3O5 and a molecular weight of 339.27 g/mol. Its IUPAC name is 3-[(2R,3S)-3-hydroxy-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]butoxy]propanoic acid.
| Compound Name | 3-[(2R,3S)-3-hydroxy-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]butoxy]propanoic acid |
|---|---|
| PubChem CID | 146218813 |
| Molecular Formula | C12H16F3N3O5 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 3-[(2R,3S)-3-hydroxy-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]butoxy]propanoic acid |
| SMILES | C[C@H](O)[C@@H](COCCC(=O)O)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O5/c1-6(19)8(5-23-3-2-9(20)21)17-7-4-16-18-11(22)10(7)12(13,14)15/h4,6,8,19H,2-3,5H2,1H3,(H,20,21)(H2,17,18,22)/t6-,8+/m0/s1 |
| InChIKey | ORLHLZWQFBDDDW-POYBYMJQSA-N |
| XLogP | 0.44 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|