C19H32F3N3O6Si — CID 153446858
methyl 3-[(2R,3S)-3-hydroxy-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]butoxy]propanoate (PubChem CID 153446858) has the molecular formula C19H32F3N3O6Si and a molecular weight of 483.56 g/mol. Its IUPAC name is methyl 3-[(2R,3S)-3-hydroxy-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]butoxy]propanoate.
| Compound Name | methyl 3-[(2R,3S)-3-hydroxy-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]butoxy]propanoate |
|---|---|
| PubChem CID | 153446858 |
| Molecular Formula | C19H32F3N3O6Si |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | methyl 3-[(2R,3S)-3-hydroxy-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]butoxy]propanoate |
| SMILES | COC(=O)CCOC[C@@H](Nc1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F)[C@H](C)O |
| InChI | InChI=1S/C19H32F3N3O6Si/c1-13(26)15(11-30-7-6-16(27)29-2)24-14-10-23-25(12-31-8-9-32(3,4)5)18(28)17(14)19(20,21)22/h10,13,15,24,26H,6-9,11-12H2,1-5H3/t13-,15+/m0/s1 |
| InChIKey | OGAOGBXJLVSAPS-DZGCQCFKSA-N |
| XLogP | 2.32 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|