C24H32F3N3O5Si — CID 153446806
methyl 3-[[1-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]-2,3-dihydro-1H-inden-2-yl]oxy]propanoate (PubChem CID 153446806) has the molecular formula C24H32F3N3O5Si and a molecular weight of 527.62 g/mol. Its IUPAC name is methyl 3-[[1-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]-2,3-dihydro-1H-inden-2-yl]oxy]propanoate.
| Compound Name | methyl 3-[[1-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]-2,3-dihydro-1H-inden-2-yl]oxy]propanoate |
|---|---|
| PubChem CID | 153446806 |
| Molecular Formula | C24H32F3N3O5Si |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | methyl 3-[[1-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]-2,3-dihydro-1H-inden-2-yl]oxy]propanoate |
| SMILES | COC(=O)CCOC1Cc2ccccc2C1Nc1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C24H32F3N3O5Si/c1-33-20(31)9-10-35-19-13-16-7-5-6-8-17(16)22(19)29-18-14-28-30(15-34-11-12-36(2,3)4)23(32)21(18)24(25,26)27/h5-8,14,19,22,29H,9-13,15H2,1-4H3 |
| InChIKey | BVFBFGOBVMZOQL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|