C17H28F3N3O3Si — CID 151432991
5-[(2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidin-1-yl]-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one (PubChem CID 151432991) has the molecular formula C17H28F3N3O3Si and a molecular weight of 407.51 g/mol. Its IUPAC name is 5-[(2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidin-1-yl]-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one.
| Compound Name | 5-[(2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidin-1-yl]-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 151432991 |
| Molecular Formula | C17H28F3N3O3Si |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 5-[(2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidin-1-yl]-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
| SMILES | C[C@H]1C[C@@H](CO)N(c2cnn(COCC[Si](C)(C)C)c(=O)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H28F3N3O3Si/c1-12-7-13(10-24)22(9-12)14-8-21-23(11-26-5-6-27(2,3)4)16(25)15(14)17(18,19)20/h8,12-13,24H,5-7,9-11H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | PCWXYEDIUHGXNI-STQMWFEESA-N |
| XLogP | 2.78 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|