C21H34F3N3O5Si — CID 150330028
3-methyl-4-[[(2S)-1-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]pyrrolidin-2-yl]methoxy]butanoic acid (PubChem CID 150330028) has the molecular formula C21H34F3N3O5Si and a molecular weight of 493.60 g/mol. Its IUPAC name is 3-methyl-4-[[(2S)-1-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]pyrrolidin-2-yl]methoxy]butanoic acid.
| Compound Name | 3-methyl-4-[[(2S)-1-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]pyrrolidin-2-yl]methoxy]butanoic acid |
|---|---|
| PubChem CID | 150330028 |
| Molecular Formula | C21H34F3N3O5Si |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 3-methyl-4-[[(2S)-1-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]pyrrolidin-2-yl]methoxy]butanoic acid |
| SMILES | CC(COC[C@@H]1CCCN1c1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C21H34F3N3O5Si/c1-15(10-18(28)29)12-32-13-16-6-5-7-26(16)17-11-25-27(14-31-8-9-33(2,3)4)20(30)19(17)21(22,23)24/h11,15-16H,5-10,12-14H2,1-4H3,(H,28,29)/t15?,16-/m0/s1 |
| InChIKey | GPLUDPAVAVAUGN-LYKKTTPLSA-N |
| XLogP | 3.67 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|