C27H39F3N4O4Si — CID 150841470
tert-butyl 3-[[2-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]-1,3-dihydroisoindol-1-yl]methylamino]propanoate (PubChem CID 150841470) has the molecular formula C27H39F3N4O4Si and a molecular weight of 568.71 g/mol. Its IUPAC name is tert-butyl 3-[[2-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]-1,3-dihydroisoindol-1-yl]methylamino]propanoate.
| Compound Name | tert-butyl 3-[[2-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]-1,3-dihydroisoindol-1-yl]methylamino]propanoate |
|---|---|
| PubChem CID | 150841470 |
| Molecular Formula | C27H39F3N4O4Si |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | tert-butyl 3-[[2-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]-1,3-dihydroisoindol-1-yl]methylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNCC1c2ccccc2CN1c1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C27H39F3N4O4Si/c1-26(2,3)38-23(35)11-12-31-15-21-20-10-8-7-9-19(20)17-33(21)22-16-32-34(18-37-13-14-39(4,5)6)25(36)24(22)27(28,29)30/h7-10,16,21,31H,11-15,17-18H2,1-6H3 |
| InChIKey | KOBOYKQTTDDRGG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|