C19H30F3N3O5Si — CID 175394482
ethyl 2-[[(1R,2R)-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]cyclopropyl]methoxy]acetate (PubChem CID 175394482) has the molecular formula C19H30F3N3O5Si and a molecular weight of 465.55 g/mol. Its IUPAC name is ethyl 2-[[(1R,2R)-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]cyclopropyl]methoxy]acetate.
| Compound Name | ethyl 2-[[(1R,2R)-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]cyclopropyl]methoxy]acetate |
|---|---|
| PubChem CID | 175394482 |
| Molecular Formula | C19H30F3N3O5Si |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | ethyl 2-[[(1R,2R)-2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]cyclopropyl]methoxy]acetate |
| SMILES | CCOC(=O)COC[C@@H]1C[C@H]1Nc1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C19H30F3N3O5Si/c1-5-30-16(26)11-29-10-13-8-14(13)24-15-9-23-25(12-28-6-7-31(2,3)4)18(27)17(15)19(20,21)22/h9,13-14,24H,5-8,10-12H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | MGEPCSHMAIYKAM-UONOGXRCSA-N |
| XLogP | 2.95 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|