C18H26F3N3O4Si — CID 165392685
ethyl 2-[4-oxo-3-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-1-yl]propanoate (PubChem CID 165392685) has the molecular formula C18H26F3N3O4Si and a molecular weight of 433.50 g/mol. Its IUPAC name is ethyl 2-[4-oxo-3-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-1-yl]propanoate.
| Compound Name | ethyl 2-[4-oxo-3-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-1-yl]propanoate |
|---|---|
| PubChem CID | 165392685 |
| Molecular Formula | C18H26F3N3O4Si |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | ethyl 2-[4-oxo-3-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)n1cc(C(F)(F)F)c2c(=O)n(COCC[Si](C)(C)C)ncc21 |
| InChI | InChI=1S/C18H26F3N3O4Si/c1-6-28-17(26)12(2)23-10-13(18(19,20)21)15-14(23)9-22-24(16(15)25)11-27-7-8-29(3,4)5/h9-10,12H,6-8,11H2,1-5H3 |
| InChIKey | CEZUCCFHAXEIJM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|