C24H43N3O4Si2 — CID 66603047
3-(1-butoxyethenyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66603047) has the molecular formula C24H43N3O4Si2 and a molecular weight of 493.80 g/mol. Its IUPAC name is 3-(1-butoxyethenyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 3-(1-butoxyethenyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66603047 |
| Molecular Formula | C24H43N3O4Si2 |
| Molecular Weight | 493.80 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 3-(1-butoxyethenyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C=C(OCCCC)c1cn(COCC[Si](C)(C)C)c2cnn(COCC[Si](C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C24H43N3O4Si2/c1-9-10-11-31-20(2)21-17-26(18-29-12-14-32(3,4)5)22-16-25-27(24(28)23(21)22)19-30-13-15-33(6,7)8/h16-17H,2,9-15,18-19H2,1,3-8H3 |
| InChIKey | GMJQSXJFFVTUJZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.80 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|