C22H34N4O3Si — CID 175071598
4-[4-methyl-3-prop-1-en-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]piperazine-1-carboxylic acid (PubChem CID 175071598) has the molecular formula C22H34N4O3Si and a molecular weight of 430.63 g/mol. Its IUPAC name is 4-[4-methyl-3-prop-1-en-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-methyl-3-prop-1-en-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175071598 |
| Molecular Formula | C22H34N4O3Si |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 4-[4-methyl-3-prop-1-en-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]piperazine-1-carboxylic acid |
| SMILES | C=C(C)c1cn(COCC[Si](C)(C)C)c2cnc(N3CCN(C(=O)O)CC3)c(C)c12 |
| InChI | InChI=1S/C22H34N4O3Si/c1-16(2)18-14-26(15-29-11-12-30(4,5)6)19-13-23-21(17(3)20(18)19)24-7-9-25(10-8-24)22(27)28/h13-14H,1,7-12,15H2,2-6H3,(H,27,28) |
| InChIKey | INSRIFPRJDIOQZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|