C15H25NO4Si — CID 90036511
ethyl 5-formyl-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate (PubChem CID 90036511) has the molecular formula C15H25NO4Si and a molecular weight of 311.45 g/mol. Its IUPAC name is ethyl 5-formyl-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 5-formyl-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 90036511 |
| Molecular Formula | C15H25NO4Si |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | ethyl 5-formyl-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cn(COCC[Si](C)(C)C)c(C=O)c1C |
| InChI | InChI=1S/C15H25NO4Si/c1-6-20-15(18)13-9-16(14(10-17)12(13)2)11-19-7-8-21(3,4)5/h9-10H,6-8,11H2,1-5H3 |
| InChIKey | IXTIJSGYGTZIKK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|