C14H24N2O4Si — CID 166074597
ethyl 2-formyl-5-methyl-3-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylate (PubChem CID 166074597) has the molecular formula C14H24N2O4Si and a molecular weight of 312.44 g/mol. Its IUPAC name is ethyl 2-formyl-5-methyl-3-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylate.
| Compound Name | ethyl 2-formyl-5-methyl-3-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 166074597 |
| Molecular Formula | C14H24N2O4Si |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | ethyl 2-formyl-5-methyl-3-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(C=O)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C14H24N2O4Si/c1-6-20-14(18)13-11(2)15-12(9-17)16(13)10-19-7-8-21(3,4)5/h9H,6-8,10H2,1-5H3 |
| InChIKey | KVHRBQQIQPJQBI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|