C17H24N2O2Si — CID 22018699
4-methyl-5-phenyl-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbaldehyde (PubChem CID 22018699) has the molecular formula C17H24N2O2Si and a molecular weight of 316.48 g/mol. Its IUPAC name is 4-methyl-5-phenyl-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbaldehyde.
| Compound Name | 4-methyl-5-phenyl-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbaldehyde |
|---|---|
| PubChem CID | 22018699 |
| Molecular Formula | C17H24N2O2Si |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4-methyl-5-phenyl-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbaldehyde |
| SMILES | Cc1nc(C=O)n(COCC[Si](C)(C)C)c1-c1ccccc1 |
| InChI | InChI=1S/C17H24N2O2Si/c1-14-17(15-8-6-5-7-9-15)19(16(12-20)18-14)13-21-10-11-22(2,3)4/h5-9,12H,10-11,13H2,1-4H3 |
| InChIKey | CATUNBZMZGUKQS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|