C26H32N2O3Si — CID 54334591
ethyl 3-[4,5-diphenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enoate (PubChem CID 54334591) has the molecular formula C26H32N2O3Si and a molecular weight of 448.64 g/mol. Its IUPAC name is ethyl 3-[4,5-diphenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enoate.
| Compound Name | ethyl 3-[4,5-diphenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 54334591 |
| Molecular Formula | C26H32N2O3Si |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | ethyl 3-[4,5-diphenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1nc(-c2ccccc2)c(-c2ccccc2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H32N2O3Si/c1-5-31-24(29)17-16-23-27-25(21-12-8-6-9-13-21)26(22-14-10-7-11-15-22)28(23)20-30-18-19-32(2,3)4/h6-17H,5,18-20H2,1-4H3 |
| InChIKey | TUOBMYCVSOUSRC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|