C27H34N2O4Si — CID 59641866
trans-methyl (1S,2S)-2-[5-(4-methoxyphenyl)-2-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]cyclopropane-1-carboxylate (PubChem CID 59641866) has the molecular formula C27H34N2O4Si and a molecular weight of 478.67 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-[5-(4-methoxyphenyl)-2-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-[5-(4-methoxyphenyl)-2-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 59641866 |
| Molecular Formula | C27H34N2O4Si |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | trans-methyl (1S,2S)-2-[5-(4-methoxyphenyl)-2-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]1c1nc(-c2ccccc2)n(COCC[Si](C)(C)C)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H34N2O4Si/c1-31-21-13-11-19(12-14-21)25-24(22-17-23(22)27(30)32-2)28-26(20-9-7-6-8-10-20)29(25)18-33-15-16-34(3,4)5/h6-14,22-23H,15-18H2,1-5H3/t22-,23-/m0/s1 |
| InChIKey | SRVASJARWLSJKB-GOTSBHOMSA-N |
| XLogP | 5.81 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|